C16H16O2S — CID 11637616
S-phenyl (2R,3R)-3-hydroxy-2-methyl-3-phenylpropanethioate (PubChem CID 11637616) has the molecular formula C16H16O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is S-phenyl (2R,3R)-3-hydroxy-2-methyl-3-phenylpropanethioate.
| Compound Name | S-phenyl (2R,3R)-3-hydroxy-2-methyl-3-phenylpropanethioate |
|---|---|
| PubChem CID | 11637616 |
| Molecular Formula | C16H16O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | S-phenyl (2R,3R)-3-hydroxy-2-methyl-3-phenylpropanethioate |
| SMILES | C[C@@H](C(=O)Sc1ccccc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C16H16O2S/c1-12(15(17)13-8-4-2-5-9-13)16(18)19-14-10-6-3-7-11-14/h2-12,15,17H,1H3/t12-,15-/m1/s1 |
| InChIKey | SYHUSISPSSCAFY-IUODEOHRSA-N |
| XLogP | 3.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|