C19H22O3 — CID 14585808
(1S,5S)-1,5-dihydroxy-1,7-diphenylheptan-3-one (PubChem CID 14585808) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is (1S,5S)-1,5-dihydroxy-1,7-diphenylheptan-3-one.
| Compound Name | (1S,5S)-1,5-dihydroxy-1,7-diphenylheptan-3-one |
|---|---|
| PubChem CID | 14585808 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (1S,5S)-1,5-dihydroxy-1,7-diphenylheptan-3-one |
| SMILES | O=C(C[C@@H](O)CCc1ccccc1)C[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C19H22O3/c20-17(12-11-15-7-3-1-4-8-15)13-18(21)14-19(22)16-9-5-2-6-10-16/h1-10,17,19-20,22H,11-14H2/t17-,19-/m0/s1 |
| InChIKey | RWQRFNIOVAJJRY-HKUYNNGSSA-N |
| XLogP | 3.06 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |