About 2-hydroxy-1,2-diphenylethanone
2-hydroxy-1,2-diphenylethanone (PubChem CID 8400) has the molecular formula C14H12O2
and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-hydroxy-1,2-diphenylethanone.
Molecular Properties
| Compound Name | 2-hydroxy-1,2-diphenylethanone |
| PubChem CID | 8400 |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2-hydroxy-1,2-diphenylethanone |
| SMILES | O=C(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C14H12O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13,15H |
| InChIKey | ISAOCJYIOMOJEB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-hydroxy-1,2-diphenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-1,2-diphenylethanone?
The IUPAC name of 2-hydroxy-1,2-diphenylethanone (CID 8400) is 2-hydroxy-1,2-diphenylethanone.
What is the SMILES notation for 2-hydroxy-1,2-diphenylethanone?
The canonical SMILES for 2-hydroxy-1,2-diphenylethanone is O=C(c1ccccc1)C(O)c1ccccc1.
What is the InChIKey of 2-hydroxy-1,2-diphenylethanone?
The InChIKey is ISAOCJYIOMOJEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13,15H.
What are the key properties of 2-hydroxy-1,2-diphenylethanone?
2-hydroxy-1,2-diphenylethanone has a molecular weight of 212.25 g/mol, XLogP of 2.60, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1,2-diphenylethanone is sourced from PubChem (CID 8400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).