About 2-benzoylbenzoic acid
2-benzoylbenzoic acid (PubChem CID 6813) has the molecular formula C14H10O3
and a molecular weight of 226.23 g/mol. Its IUPAC name is 2-benzoylbenzoic acid.
Molecular Properties
| Compound Name | 2-benzoylbenzoic acid |
| PubChem CID | 6813 |
| Molecular Formula | C14H10O3 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 2-benzoylbenzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C14H10O3/c15-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)14(16)17/h1-9H,(H,16,17) |
| InChIKey | FGTYTUFKXYPTML-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzoylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzoylbenzoic acid?
The IUPAC name of 2-benzoylbenzoic acid (CID 6813) is 2-benzoylbenzoic acid.
What is the SMILES notation for 2-benzoylbenzoic acid?
The canonical SMILES for 2-benzoylbenzoic acid is O=C(O)c1ccccc1C(=O)c1ccccc1.
What is the InChIKey of 2-benzoylbenzoic acid?
The InChIKey is FGTYTUFKXYPTML-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O3/c15-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)14(16)17/h1-9H,(H,16,17).
What are the key properties of 2-benzoylbenzoic acid?
2-benzoylbenzoic acid has a molecular weight of 226.23 g/mol, XLogP of 2.62, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzoylbenzoic acid is sourced from PubChem (CID 6813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).