C18H20O2 — CID 44585754
1-Hydroxy-1,6-diphenylhexan-3-one (PubChem CID 44585754) has the molecular formula C18H20O2 and a molecular weight of 268.30 g/mol. Its IUPAC name is 1-hydroxy-1,6-diphenylhexan-3-one.
| Compound Name | 1-Hydroxy-1,6-diphenylhexan-3-one |
|---|---|
| PubChem CID | 44585754 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 1-hydroxy-1,6-diphenylhexan-3-one |
| SMILES | C1=CC=C(C=C1)CCCC(=O)CC(C2=CC=CC=C2)O |
| InChI | InChI=1S/C18H20O2/c19-17(13-7-10-15-8-3-1-4-9-15)14-18(20)16-11-5-2-6-12-16/h1-6,8-9,11-12,18,20H,7,10,13-14H2 |
| InChIKey | JQHUVCFPXGONQI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | 275 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |