C21H30O6S — CID 10341522
tert-butyl (8S)-8-hydroxy-2-methyl-9-[(R)-(4-methylphenyl)sulfinyl]-3,6-dioxononanoate (PubChem CID 10341522) has the molecular formula C21H30O6S and a molecular weight of 410.53 g/mol. Its IUPAC name is tert-butyl (8S)-8-hydroxy-2-methyl-9-[(R)-(4-methylphenyl)sulfinyl]-3,6-dioxononanoate.
| Compound Name | tert-butyl (8S)-8-hydroxy-2-methyl-9-[(R)-(4-methylphenyl)sulfinyl]-3,6-dioxononanoate |
|---|---|
| PubChem CID | 10341522 |
| Molecular Formula | C21H30O6S |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | tert-butyl (8S)-8-hydroxy-2-methyl-9-[(R)-(4-methylphenyl)sulfinyl]-3,6-dioxononanoate |
| SMILES | Cc1ccc([S@](=O)C[C@@H](O)CC(=O)CCC(=O)C(C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H30O6S/c1-14-6-9-18(10-7-14)28(26)13-17(23)12-16(22)8-11-19(24)15(2)20(25)27-21(3,4)5/h6-7,9-10,15,17,23H,8,11-13H2,1-5H3/t15?,17-,28+/m0/s1 |
| InChIKey | PRPOVMLMVCQFNF-UDWKOXRGSA-N |
| XLogP | 2.75 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|