C24H34O8S — CID 102080365
diethyl 2-(5-hydroxy-5-methyl-2-oxohexyl)-2-[(E)-3-(4-methylphenyl)sulfonylprop-2-enyl]propanedioate (PubChem CID 102080365) has the molecular formula C24H34O8S and a molecular weight of 482.60 g/mol. Its IUPAC name is diethyl 2-(5-hydroxy-5-methyl-2-oxohexyl)-2-[(E)-3-(4-methylphenyl)sulfonylprop-2-enyl]propanedioate.
| Compound Name | diethyl 2-(5-hydroxy-5-methyl-2-oxohexyl)-2-[(E)-3-(4-methylphenyl)sulfonylprop-2-enyl]propanedioate |
|---|---|
| PubChem CID | 102080365 |
| Molecular Formula | C24H34O8S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | diethyl 2-(5-hydroxy-5-methyl-2-oxohexyl)-2-[(E)-3-(4-methylphenyl)sulfonylprop-2-enyl]propanedioate |
| SMILES | CCOC(=O)C(C/C=C/S(=O)(=O)c1ccc(C)cc1)(CC(=O)CCC(C)(C)O)C(=O)OCC |
| InChI | InChI=1S/C24H34O8S/c1-6-31-21(26)24(22(27)32-7-2,17-19(25)13-15-23(4,5)28)14-8-16-33(29,30)20-11-9-18(3)10-12-20/h8-12,16,28H,6-7,13-15,17H2,1-5H3/b16-8+ |
| InChIKey | IPGPDROASLNPRZ-LZYBPNLTSA-N |
| XLogP | 3.30 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|