C25H34O7S — CID 139055778
ditert-butyl (5R)-5-(benzenesulfonyl)-3-methylidene-6-oxocyclooctane-1,1-dicarboxylate (PubChem CID 139055778) has the molecular formula C25H34O7S and a molecular weight of 478.61 g/mol. Its IUPAC name is ditert-butyl (5R)-5-(benzenesulfonyl)-3-methylidene-6-oxocyclooctane-1,1-dicarboxylate.
| Compound Name | ditert-butyl (5R)-5-(benzenesulfonyl)-3-methylidene-6-oxocyclooctane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 139055778 |
| Molecular Formula | C25H34O7S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | ditert-butyl (5R)-5-(benzenesulfonyl)-3-methylidene-6-oxocyclooctane-1,1-dicarboxylate |
| SMILES | C=C1C[C@@H](S(=O)(=O)c2ccccc2)C(=O)CCC(C(=O)OC(C)(C)C)(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C25H34O7S/c1-17-15-20(33(29,30)18-11-9-8-10-12-18)19(26)13-14-25(16-17,21(27)31-23(2,3)4)22(28)32-24(5,6)7/h8-12,20H,1,13-16H2,2-7H3/t20-/m1/s1 |
| InChIKey | VAOSEFJVWBMDJA-HXUWFJFHSA-N |
| XLogP | 4.20 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|