C20H20O7S — CID 135016675
dimethyl 4-(benzenesulfonyl)-2-oxo-1,4,5,7-tetrahydroazulene-6,6-dicarboxylate (PubChem CID 135016675) has the molecular formula C20H20O7S and a molecular weight of 404.44 g/mol. Its IUPAC name is dimethyl 4-(benzenesulfonyl)-2-oxo-1,4,5,7-tetrahydroazulene-6,6-dicarboxylate.
| Compound Name | dimethyl 4-(benzenesulfonyl)-2-oxo-1,4,5,7-tetrahydroazulene-6,6-dicarboxylate |
|---|---|
| PubChem CID | 135016675 |
| Molecular Formula | C20H20O7S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | dimethyl 4-(benzenesulfonyl)-2-oxo-1,4,5,7-tetrahydroazulene-6,6-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC=C2CC(=O)C=C2C(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C20H20O7S/c1-26-18(22)20(19(23)27-2)9-8-13-10-14(21)11-16(13)17(12-20)28(24,25)15-6-4-3-5-7-15/h3-8,11,17H,9-10,12H2,1-2H3 |
| InChIKey | YUQUYYVBIOMGDG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|