C24H38O6S — CID 56650579
ditert-butyl 2-methyl-2-[5-(4-methylphenyl)sulfonylpentyl]propanedioate (PubChem CID 56650579) has the molecular formula C24H38O6S and a molecular weight of 454.63 g/mol. Its IUPAC name is ditert-butyl 2-methyl-2-[5-(4-methylphenyl)sulfonylpentyl]propanedioate.
| Compound Name | ditert-butyl 2-methyl-2-[5-(4-methylphenyl)sulfonylpentyl]propanedioate |
|---|---|
| PubChem CID | 56650579 |
| Molecular Formula | C24H38O6S |
| Molecular Weight | 454.63 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | ditert-butyl 2-methyl-2-[5-(4-methylphenyl)sulfonylpentyl]propanedioate |
| SMILES | Cc1ccc(S(=O)(=O)CCCCCC(C)(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H38O6S/c1-18-12-14-19(15-13-18)31(27,28)17-11-9-10-16-24(8,20(25)29-22(2,3)4)21(26)30-23(5,6)7/h12-15H,9-11,16-17H2,1-8H3 |
| InChIKey | IACRAIBJDYFLML-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.63 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|