C16H20O2S — CID 12693045
2-[hydroxy-(1-phenylsulfanylcyclopropyl)methyl]cyclohexan-1-one (PubChem CID 12693045) has the molecular formula C16H20O2S and a molecular weight of 276.40 g/mol. Its IUPAC name is 2-[hydroxy-(1-phenylsulfanylcyclopropyl)methyl]cyclohexan-1-one.
| Compound Name | 2-[hydroxy-(1-phenylsulfanylcyclopropyl)methyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 12693045 |
| Molecular Formula | C16H20O2S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-[hydroxy-(1-phenylsulfanylcyclopropyl)methyl]cyclohexan-1-one |
| SMILES | O=C1CCCCC1C(O)C1(Sc2ccccc2)CC1 |
| InChI | InChI=1S/C16H20O2S/c17-14-9-5-4-8-13(14)15(18)16(10-11-16)19-12-6-2-1-3-7-12/h1-3,6-7,13,15,18H,4-5,8-11H2 |
| InChIKey | YDFBEHWMZYFQIJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |