C32H60O6SSi2 — CID 134877812
tert-butyl (4R,5R,6S,7S)-8-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-5,7-dimethyl-4-triethylsilyloxyoctanoate (PubChem CID 134877812) has the molecular formula C32H60O6SSi2 and a molecular weight of 629.07 g/mol. Its IUPAC name is tert-butyl (4R,5R,6S,7S)-8-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-5,7-dimethyl-4-triethylsilyloxyoctanoate.
| Compound Name | tert-butyl (4R,5R,6S,7S)-8-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-5,7-dimethyl-4-triethylsilyloxyoctanoate |
|---|---|
| PubChem CID | 134877812 |
| Molecular Formula | C32H60O6SSi2 |
| Molecular Weight | 629.07 g/mol |
| Exact Mass | 628.36 |
| IUPAC Name | tert-butyl (4R,5R,6S,7S)-8-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-5,7-dimethyl-4-triethylsilyloxyoctanoate |
| SMILES | CC[Si](CC)(CC)O[C@H](CCC(=O)OC(C)(C)C)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H60O6SSi2/c1-14-41(15-2,16-3)37-28(22-23-29(33)36-31(6,7)8)26(5)30(38-40(12,13)32(9,10)11)25(4)24-39(34,35)27-20-18-17-19-21-27/h17-21,25-26,28,30H,14-16,22-24H2,1-13H3/t25-,26-,28-,30-/m1/s1 |
| InChIKey | NRRALYUHJDDRST-QXMDYEBFSA-N |
| XLogP | 8.64 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.07 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|