C31H52O7SSi2 — CID 10985028
5-(benzenesulfonyl)-6-[(2R,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-7-trimethylsilylhept-6-yn-2-yl]-3,3-dimethoxy-5-methyloxan-2-one (PubChem CID 10985028) has the molecular formula C31H52O7SSi2 and a molecular weight of 624.99 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-6-[(2R,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-7-trimethylsilylhept-6-yn-2-yl]-3,3-dimethoxy-5-methyloxan-2-one.
| Compound Name | 5-(benzenesulfonyl)-6-[(2R,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-7-trimethylsilylhept-6-yn-2-yl]-3,3-dimethoxy-5-methyloxan-2-one |
|---|---|
| PubChem CID | 10985028 |
| Molecular Formula | C31H52O7SSi2 |
| Molecular Weight | 624.99 g/mol |
| Exact Mass | 624.30 |
| IUPAC Name | 5-(benzenesulfonyl)-6-[(2R,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-7-trimethylsilylhept-6-yn-2-yl]-3,3-dimethoxy-5-methyloxan-2-one |
| SMILES | COC1(OC)CC(C)(S(=O)(=O)c2ccccc2)C([C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CC#C[Si](C)(C)C)OC1=O |
| InChI | InChI=1S/C31H52O7SSi2/c1-23(18-17-21-40(9,10)11)26(38-41(12,13)29(3,4)5)24(2)27-30(6,22-31(35-7,36-8)28(32)37-27)39(33,34)25-19-15-14-16-20-25/h14-16,19-20,23-24,26-27H,18,22H2,1-13H3/t23-,24-,26-,27?,30?/m0/s1 |
| InChIKey | TZGZPWVXYSXFLT-DOLPUBFSSA-N |
| XLogP | 6.46 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.99 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|