C21H34O4SSi — CID 11464028
8-[tert-butyl(dimethyl)silyl]oxy-1-[(R)-(4-methylphenyl)sulfinyl]octane-2,4-dione (PubChem CID 11464028) has the molecular formula C21H34O4SSi and a molecular weight of 410.65 g/mol. Its IUPAC name is 8-[tert-butyl(dimethyl)silyl]oxy-1-[(R)-(4-methylphenyl)sulfinyl]octane-2,4-dione.
| Compound Name | 8-[tert-butyl(dimethyl)silyl]oxy-1-[(R)-(4-methylphenyl)sulfinyl]octane-2,4-dione |
|---|---|
| PubChem CID | 11464028 |
| Molecular Formula | C21H34O4SSi |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 8-[tert-butyl(dimethyl)silyl]oxy-1-[(R)-(4-methylphenyl)sulfinyl]octane-2,4-dione |
| SMILES | Cc1ccc([S@](=O)CC(=O)CC(=O)CCCCO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H34O4SSi/c1-17-10-12-20(13-11-17)26(24)16-19(23)15-18(22)9-7-8-14-25-27(5,6)21(2,3)4/h10-13H,7-9,14-16H2,1-6H3/t26-/m1/s1 |
| InChIKey | ORQRSKZHVVUFTG-AREMUKBSSA-N |
| XLogP | 4.82 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|