C13H16O6S — CID 101209161
ethyl 3-(benzenesulfonyl)-5-hydroxy-4-oxo(313C)pentanoate (PubChem CID 101209161) has the molecular formula C13H16O6S and a molecular weight of 301.32 g/mol. Its IUPAC name is ethyl 3-(benzenesulfonyl)-5-hydroxy-4-oxo(313C)pentanoate.
| Compound Name | ethyl 3-(benzenesulfonyl)-5-hydroxy-4-oxo(313C)pentanoate |
|---|---|
| PubChem CID | 101209161 |
| Molecular Formula | C13H16O6S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | ethyl 3-(benzenesulfonyl)-5-hydroxy-4-oxo(313C)pentanoate |
| SMILES | CCOC(=O)C[13CH](C(=O)CO)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H16O6S/c1-2-19-13(16)8-12(11(15)9-14)20(17,18)10-6-4-3-5-7-10/h3-7,12,14H,2,8-9H2,1H3/i12+1 |
| InChIKey | WMUYIJOKTZTNHB-HNHCFKFXSA-N |
| XLogP | 0.34 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |