C18H28O4SSi — CID 10406752
[(2R,3R)-3-(benzenesulfonyl)-3-prop-2-enyloxiran-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 10406752) has the molecular formula C18H28O4SSi and a molecular weight of 368.57 g/mol. Its IUPAC name is [(2R,3R)-3-(benzenesulfonyl)-3-prop-2-enyloxiran-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R)-3-(benzenesulfonyl)-3-prop-2-enyloxiran-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10406752 |
| Molecular Formula | C18H28O4SSi |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | [(2R,3R)-3-(benzenesulfonyl)-3-prop-2-enyloxiran-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C=CC[C@]1(S(=O)(=O)c2ccccc2)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H28O4SSi/c1-7-13-18(23(19,20)15-11-9-8-10-12-15)16(22-18)14-21-24(5,6)17(2,3)4/h7-12,16H,1,13-14H2,2-6H3/t16-,18-/m1/s1 |
| InChIKey | CFCAMJBWAADXPS-SJLPKXTDSA-N |
| XLogP | 4.15 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|