C18H28O6S2Si — CID 13174097
[(1S,4R)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl] methanesulfonate (PubChem CID 13174097) has the molecular formula C18H28O6S2Si and a molecular weight of 432.64 g/mol. Its IUPAC name is [(1S,4R)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl] methanesulfonate.
| Compound Name | [(1S,4R)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl] methanesulfonate |
|---|---|
| PubChem CID | 13174097 |
| Molecular Formula | C18H28O6S2Si |
| Molecular Weight | 432.64 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | [(1S,4R)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl] methanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C=C(S(=O)(=O)c2ccccc2)[C@@H](OS(C)(=O)=O)C1 |
| InChI | InChI=1S/C18H28O6S2Si/c1-18(2,3)27(5,6)24-14-12-16(23-25(4,19)20)17(13-14)26(21,22)15-10-8-7-9-11-15/h7-11,13-14,16H,12H2,1-6H3/t14-,16+/m1/s1 |
| InChIKey | RETSWRHNQIZVQU-ZBFHGGJFSA-N |
| XLogP | 3.48 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.64 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|