C20H34O3SSi — CID 154707214
[(E,2S,5R)-6-(benzenesulfonyl)-3,5-dimethylhex-3-en-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 154707214) has the molecular formula C20H34O3SSi and a molecular weight of 382.64 g/mol. Its IUPAC name is [(E,2S,5R)-6-(benzenesulfonyl)-3,5-dimethylhex-3-en-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(E,2S,5R)-6-(benzenesulfonyl)-3,5-dimethylhex-3-en-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 154707214 |
| Molecular Formula | C20H34O3SSi |
| Molecular Weight | 382.64 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | [(E,2S,5R)-6-(benzenesulfonyl)-3,5-dimethylhex-3-en-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C/C(=C\[C@@H](C)CS(=O)(=O)c1ccccc1)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34O3SSi/c1-16(15-24(21,22)19-12-10-9-11-13-19)14-17(2)18(3)23-25(7,8)20(4,5)6/h9-14,16,18H,15H2,1-8H3/b17-14+/t16-,18+/m1/s1 |
| InChIKey | OJKFWWWCAUCFME-BCGGDATKSA-N |
| XLogP | 5.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.64 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|