C19H24O4SSi — CID 10992444
8-(benzenesulfonyl)-4-hydroxy-3-trimethylsilyl-4,5,6,7-tetrahydro-1H-azulen-2-one (PubChem CID 10992444) has the molecular formula C19H24O4SSi and a molecular weight of 376.55 g/mol. Its IUPAC name is 8-(benzenesulfonyl)-4-hydroxy-3-trimethylsilyl-4,5,6,7-tetrahydro-1H-azulen-2-one.
| Compound Name | 8-(benzenesulfonyl)-4-hydroxy-3-trimethylsilyl-4,5,6,7-tetrahydro-1H-azulen-2-one |
|---|---|
| PubChem CID | 10992444 |
| Molecular Formula | C19H24O4SSi |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 8-(benzenesulfonyl)-4-hydroxy-3-trimethylsilyl-4,5,6,7-tetrahydro-1H-azulen-2-one |
| SMILES | C[Si](C)(C)C1=C2C(=C(S(=O)(=O)c3ccccc3)CCCC2O)CC1=O |
| InChI | InChI=1S/C19H24O4SSi/c1-25(2,3)19-16(21)12-14-17(11-7-10-15(20)18(14)19)24(22,23)13-8-5-4-6-9-13/h4-6,8-9,15,20H,7,10-12H2,1-3H3 |
| InChIKey | KBQJSSBVAIBZNZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|