C28H34O4SSi — CID 11027425
8-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-phenyl-4,5,6,7-tetrahydro-1H-azulen-2-one (PubChem CID 11027425) has the molecular formula C28H34O4SSi and a molecular weight of 494.73 g/mol. Its IUPAC name is 8-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-phenyl-4,5,6,7-tetrahydro-1H-azulen-2-one.
| Compound Name | 8-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-phenyl-4,5,6,7-tetrahydro-1H-azulen-2-one |
|---|---|
| PubChem CID | 11027425 |
| Molecular Formula | C28H34O4SSi |
| Molecular Weight | 494.73 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 8-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-phenyl-4,5,6,7-tetrahydro-1H-azulen-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCCC(S(=O)(=O)c2ccccc2)=C2CC(=O)C(c3ccccc3)=C21 |
| InChI | InChI=1S/C28H34O4SSi/c1-28(2,3)34(4,5)32-24-17-12-18-25(33(30,31)21-15-10-7-11-16-21)22-19-23(29)26(27(22)24)20-13-8-6-9-14-20/h6-11,13-16,24H,12,17-19H2,1-5H3 |
| InChIKey | DDQYDBACOXDITA-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.73 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|