C22H30O4SSi — CID 11761565
8-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-4,5,6,7-tetrahydro-1H-azulen-2-one (PubChem CID 11761565) has the molecular formula C22H30O4SSi and a molecular weight of 418.63 g/mol. Its IUPAC name is 8-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-4,5,6,7-tetrahydro-1H-azulen-2-one.
| Compound Name | 8-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-4,5,6,7-tetrahydro-1H-azulen-2-one |
|---|---|
| PubChem CID | 11761565 |
| Molecular Formula | C22H30O4SSi |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 8-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-4,5,6,7-tetrahydro-1H-azulen-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCCC(S(=O)(=O)c2ccccc2)=C2CC(=O)C=C21 |
| InChI | InChI=1S/C22H30O4SSi/c1-22(2,3)28(4,5)26-20-12-9-13-21(19-15-16(23)14-18(19)20)27(24,25)17-10-7-6-8-11-17/h6-8,10-11,14,20H,9,12-13,15H2,1-5H3 |
| InChIKey | QEWBVIUQIILLEM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|