C19H24O3SSi — CID 11337357
8-(benzenesulfonyl)-3-trimethylsilyl-4,5,6,7-tetrahydro-1H-azulen-2-one (PubChem CID 11337357) has the molecular formula C19H24O3SSi and a molecular weight of 360.55 g/mol. Its IUPAC name is 8-(benzenesulfonyl)-3-trimethylsilyl-4,5,6,7-tetrahydro-1H-azulen-2-one.
| Compound Name | 8-(benzenesulfonyl)-3-trimethylsilyl-4,5,6,7-tetrahydro-1H-azulen-2-one |
|---|---|
| PubChem CID | 11337357 |
| Molecular Formula | C19H24O3SSi |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 8-(benzenesulfonyl)-3-trimethylsilyl-4,5,6,7-tetrahydro-1H-azulen-2-one |
| SMILES | C[Si](C)(C)C1=C2CCCCC(S(=O)(=O)c3ccccc3)=C2CC1=O |
| InChI | InChI=1S/C19H24O3SSi/c1-24(2,3)19-15-11-7-8-12-18(16(15)13-17(19)20)23(21,22)14-9-5-4-6-10-14/h4-6,9-10H,7-8,11-13H2,1-3H3 |
| InChIKey | OYWDDCQWUXPFLN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|