C22H20O5S2 — CID 102279383
4,8-bis(benzenesulfonyl)-4,5,6,7-tetrahydro-1H-azulen-2-one (PubChem CID 102279383) has the molecular formula C22H20O5S2 and a molecular weight of 428.53 g/mol. Its IUPAC name is 4,8-bis(benzenesulfonyl)-4,5,6,7-tetrahydro-1H-azulen-2-one.
| Compound Name | 4,8-bis(benzenesulfonyl)-4,5,6,7-tetrahydro-1H-azulen-2-one |
|---|---|
| PubChem CID | 102279383 |
| Molecular Formula | C22H20O5S2 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 4,8-bis(benzenesulfonyl)-4,5,6,7-tetrahydro-1H-azulen-2-one |
| SMILES | O=C1C=C2C(=C(S(=O)(=O)c3ccccc3)CCCC2S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C22H20O5S2/c23-16-14-19-20(15-16)22(29(26,27)18-10-5-2-6-11-18)13-7-12-21(19)28(24,25)17-8-3-1-4-9-17/h1-6,8-11,14,21H,7,12-13,15H2 |
| InChIKey | RZBKKAYHQWXRJU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |