C19H20O5S2 — CID 555498
2-[2,2-bis(benzenesulfonyl)ethyl]cyclopentan-1-one (PubChem CID 555498) has the molecular formula C19H20O5S2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-[2,2-bis(benzenesulfonyl)ethyl]cyclopentan-1-one.
| Compound Name | 2-[2,2-bis(benzenesulfonyl)ethyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 555498 |
| Molecular Formula | C19H20O5S2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 2-[2,2-bis(benzenesulfonyl)ethyl]cyclopentan-1-one |
| SMILES | O=C1CCCC1CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20O5S2/c20-18-13-7-8-15(18)14-19(25(21,22)16-9-3-1-4-10-16)26(23,24)17-11-5-2-6-12-17/h1-6,9-12,15,19H,7-8,13-14H2 |
| InChIKey | QHGRMTJXTKBFAD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |