C18H22O3SSi — CID 10926063
7-(benzenesulfonyl)-3-trimethylsilyl-1,4,5,6-tetrahydroinden-2-one (PubChem CID 10926063) has the molecular formula C18H22O3SSi and a molecular weight of 346.52 g/mol. Its IUPAC name is 7-(benzenesulfonyl)-3-trimethylsilyl-1,4,5,6-tetrahydroinden-2-one.
| Compound Name | 7-(benzenesulfonyl)-3-trimethylsilyl-1,4,5,6-tetrahydroinden-2-one |
|---|---|
| PubChem CID | 10926063 |
| Molecular Formula | C18H22O3SSi |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 7-(benzenesulfonyl)-3-trimethylsilyl-1,4,5,6-tetrahydroinden-2-one |
| SMILES | C[Si](C)(C)C1=C2CCCC(S(=O)(=O)c3ccccc3)=C2CC1=O |
| InChI | InChI=1S/C18H22O3SSi/c1-23(2,3)18-14-10-7-11-17(15(14)12-16(18)19)22(20,21)13-8-5-4-6-9-13/h4-6,8-9H,7,10-12H2,1-3H3 |
| InChIKey | KJUNKPGZQPVVJY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|