C18H26O3SSi — CID 12729180
2-(benzenesulfonyl)-2-[2-(trimethylsilylmethyl)prop-2-enyl]cyclopentan-1-one (PubChem CID 12729180) has the molecular formula C18H26O3SSi and a molecular weight of 350.56 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-2-[2-(trimethylsilylmethyl)prop-2-enyl]cyclopentan-1-one.
| Compound Name | 2-(benzenesulfonyl)-2-[2-(trimethylsilylmethyl)prop-2-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 12729180 |
| Molecular Formula | C18H26O3SSi |
| Molecular Weight | 350.56 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-(benzenesulfonyl)-2-[2-(trimethylsilylmethyl)prop-2-enyl]cyclopentan-1-one |
| SMILES | C=C(CC1(S(=O)(=O)c2ccccc2)CCCC1=O)C[Si](C)(C)C |
| InChI | InChI=1S/C18H26O3SSi/c1-15(14-23(2,3)4)13-18(12-8-11-17(18)19)22(20,21)16-9-6-5-7-10-16/h5-7,9-10H,1,8,11-14H2,2-4H3 |
| InChIKey | UHPPNWPFTKGBAN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|