C16H16O4S — CID 10990344
8-(benzenesulfonyl)-7-hydroxy-4,5,6,7-tetrahydro-1H-azulen-2-one (PubChem CID 10990344) has the molecular formula C16H16O4S and a molecular weight of 304.37 g/mol. Its IUPAC name is 8-(benzenesulfonyl)-7-hydroxy-4,5,6,7-tetrahydro-1H-azulen-2-one.
| Compound Name | 8-(benzenesulfonyl)-7-hydroxy-4,5,6,7-tetrahydro-1H-azulen-2-one |
|---|---|
| PubChem CID | 10990344 |
| Molecular Formula | C16H16O4S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 8-(benzenesulfonyl)-7-hydroxy-4,5,6,7-tetrahydro-1H-azulen-2-one |
| SMILES | O=C1C=C2CCCC(O)C(S(=O)(=O)c3ccccc3)=C2C1 |
| InChI | InChI=1S/C16H16O4S/c17-12-9-11-5-4-8-15(18)16(14(11)10-12)21(19,20)13-6-2-1-3-7-13/h1-3,6-7,9,15,18H,4-5,8,10H2 |
| InChIKey | ZGBQIDMDHUEAHI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |