C22H30O4S — CID 54223374
7-[2-(3-hydroxy-4-phenylsulfanylbutyl)-5-oxocyclopenten-1-yl]heptanoic acid (PubChem CID 54223374) has the molecular formula C22H30O4S and a molecular weight of 390.55 g/mol. Its IUPAC name is 7-[2-(3-hydroxy-4-phenylsulfanylbutyl)-5-oxocyclopenten-1-yl]heptanoic acid.
| Compound Name | 7-[2-(3-hydroxy-4-phenylsulfanylbutyl)-5-oxocyclopenten-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 54223374 |
| Molecular Formula | C22H30O4S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 7-[2-(3-hydroxy-4-phenylsulfanylbutyl)-5-oxocyclopenten-1-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCC1=C(CCC(O)CSc2ccccc2)CCC1=O |
| InChI | InChI=1S/C22H30O4S/c23-18(16-27-19-8-4-3-5-9-19)14-12-17-13-15-21(24)20(17)10-6-1-2-7-11-22(25)26/h3-5,8-9,18,23H,1-2,6-7,10-16H2,(H,25,26) |
| InChIKey | QEEDTFQKEWTCNJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|