C18H22O4SSi — CID 11639147
5-(benzenesulfonyl)-8-trimethylsilyl-1,3,4,6-tetrahydrocyclopenta[c]oxepin-7-one (PubChem CID 11639147) has the molecular formula C18H22O4SSi and a molecular weight of 362.52 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-8-trimethylsilyl-1,3,4,6-tetrahydrocyclopenta[c]oxepin-7-one.
| Compound Name | 5-(benzenesulfonyl)-8-trimethylsilyl-1,3,4,6-tetrahydrocyclopenta[c]oxepin-7-one |
|---|---|
| PubChem CID | 11639147 |
| Molecular Formula | C18H22O4SSi |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 5-(benzenesulfonyl)-8-trimethylsilyl-1,3,4,6-tetrahydrocyclopenta[c]oxepin-7-one |
| SMILES | C[Si](C)(C)C1=C2COCCC(S(=O)(=O)c3ccccc3)=C2CC1=O |
| InChI | InChI=1S/C18H22O4SSi/c1-24(2,3)18-15-12-22-10-9-17(14(15)11-16(18)19)23(20,21)13-7-5-4-6-8-13/h4-8H,9-12H2,1-3H3 |
| InChIKey | QMWILQRTPJFUEP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|