C34H52O5SSi2 — CID 11072254
(3E,5S,7E,10S)-7-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-10-phenyl-10-triethylsilyloxydeca-3,7-dien-2-one (PubChem CID 11072254) has the molecular formula C34H52O5SSi2 and a molecular weight of 629.02 g/mol. Its IUPAC name is (3E,5S,7E,10S)-7-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-10-phenyl-10-triethylsilyloxydeca-3,7-dien-2-one.
| Compound Name | (3E,5S,7E,10S)-7-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-10-phenyl-10-triethylsilyloxydeca-3,7-dien-2-one |
|---|---|
| PubChem CID | 11072254 |
| Molecular Formula | C34H52O5SSi2 |
| Molecular Weight | 629.02 g/mol |
| Exact Mass | 628.31 |
| IUPAC Name | (3E,5S,7E,10S)-7-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-10-phenyl-10-triethylsilyloxydeca-3,7-dien-2-one |
| SMILES | CC[Si](CC)(CC)O[C@@H](C/C=C(\C[C@@H](/C=C/C(C)=O)O[Si](C)(C)C(C)(C)C)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H52O5SSi2/c1-10-42(11-2,12-3)39-33(29-19-15-13-16-20-29)26-25-32(40(36,37)31-21-17-14-18-22-31)27-30(24-23-28(4)35)38-41(8,9)34(5,6)7/h13-25,30,33H,10-12,26-27H2,1-9H3/b24-23+,32-25+/t30-,33+/m1/s1 |
| InChIKey | YHXKELJIPHUTDW-SGAJCINJSA-N |
| XLogP | 9.42 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.02 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|