C31H42O4SSi — CID 101073834
(1R,6R,6aR)-1-(benzenesulfonyl)-5,5-dimethyl-3-phenyl-6-tri(propan-2-yl)silyloxy-1,4,6,6a-tetrahydropentalen-2-one (PubChem CID 101073834) has the molecular formula C31H42O4SSi and a molecular weight of 538.83 g/mol. Its IUPAC name is (1R,6R,6aR)-1-(benzenesulfonyl)-5,5-dimethyl-3-phenyl-6-tri(propan-2-yl)silyloxy-1,4,6,6a-tetrahydropentalen-2-one.
| Compound Name | (1R,6R,6aR)-1-(benzenesulfonyl)-5,5-dimethyl-3-phenyl-6-tri(propan-2-yl)silyloxy-1,4,6,6a-tetrahydropentalen-2-one |
|---|---|
| PubChem CID | 101073834 |
| Molecular Formula | C31H42O4SSi |
| Molecular Weight | 538.83 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | (1R,6R,6aR)-1-(benzenesulfonyl)-5,5-dimethyl-3-phenyl-6-tri(propan-2-yl)silyloxy-1,4,6,6a-tetrahydropentalen-2-one |
| SMILES | CC(C)[Si](O[C@@H]1[C@H]2C(=C(c3ccccc3)C(=O)[C@@H]2S(=O)(=O)c2ccccc2)CC1(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C31H42O4SSi/c1-20(2)37(21(3)4,22(5)6)35-30-27-25(19-31(30,7)8)26(23-15-11-9-12-16-23)28(32)29(27)36(33,34)24-17-13-10-14-18-24/h9-18,20-22,27,29-30H,19H2,1-8H3/t27-,29+,30+/m0/s1 |
| InChIKey | HUVNDSVMDFMMTL-GNSPLJBXSA-N |
| XLogP | 7.47 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.83 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|