C19H28O2SSi — CID 56600214
(4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-6-phenylsulfanylcyclohex-2-en-1-one (PubChem CID 56600214) has the molecular formula C19H28O2SSi and a molecular weight of 348.58 g/mol. Its IUPAC name is (4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-6-phenylsulfanylcyclohex-2-en-1-one.
| Compound Name | (4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-6-phenylsulfanylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 56600214 |
| Molecular Formula | C19H28O2SSi |
| Molecular Weight | 348.58 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-6-phenylsulfanylcyclohex-2-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C=CC(=O)[C@@](C)(Sc2ccccc2)C1 |
| InChI | InChI=1S/C19H28O2SSi/c1-18(2,3)23(5,6)21-15-12-13-17(20)19(4,14-15)22-16-10-8-7-9-11-16/h7-13,15H,14H2,1-6H3/t15-,19+/m1/s1 |
| InChIKey | IKMUKMFXHGTSMU-BEFAXECRSA-N |
| XLogP | 5.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|