C19H22O3SSi — CID 24812690
2-phenylsulfanyl-8-trimethylsilyloxy-4a,5,8,8a-tetrahydronaphthalene-1,4-dione (PubChem CID 24812690) has the molecular formula C19H22O3SSi and a molecular weight of 358.54 g/mol. Its IUPAC name is 2-phenylsulfanyl-8-trimethylsilyloxy-4a,5,8,8a-tetrahydronaphthalene-1,4-dione.
| Compound Name | 2-phenylsulfanyl-8-trimethylsilyloxy-4a,5,8,8a-tetrahydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 24812690 |
| Molecular Formula | C19H22O3SSi |
| Molecular Weight | 358.54 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-phenylsulfanyl-8-trimethylsilyloxy-4a,5,8,8a-tetrahydronaphthalene-1,4-dione |
| SMILES | C[Si](C)(C)OC1C=CCC2C(=O)C=C(Sc3ccccc3)C(=O)C12 |
| InChI | InChI=1S/C19H22O3SSi/c1-24(2,3)22-16-11-7-10-14-15(20)12-17(19(21)18(14)16)23-13-8-5-4-6-9-13/h4-9,11-12,14,16,18H,10H2,1-3H3 |
| InChIKey | CVASVPWNOPEILH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|