C20H24O4SSi — CID 10596446
(4aS,8S,8aS)-8a-[(S)-(4-methylphenyl)sulfinyl]-8-trimethylsilyloxy-5,8-dihydro-4aH-naphthalene-1,4-dione (PubChem CID 10596446) has the molecular formula C20H24O4SSi and a molecular weight of 388.56 g/mol. Its IUPAC name is (4aS,8S,8aS)-8a-[(S)-(4-methylphenyl)sulfinyl]-8-trimethylsilyloxy-5,8-dihydro-4aH-naphthalene-1,4-dione.
| Compound Name | (4aS,8S,8aS)-8a-[(S)-(4-methylphenyl)sulfinyl]-8-trimethylsilyloxy-5,8-dihydro-4aH-naphthalene-1,4-dione |
|---|---|
| PubChem CID | 10596446 |
| Molecular Formula | C20H24O4SSi |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | (4aS,8S,8aS)-8a-[(S)-(4-methylphenyl)sulfinyl]-8-trimethylsilyloxy-5,8-dihydro-4aH-naphthalene-1,4-dione |
| SMILES | Cc1ccc([S@](=O)[C@@]23C(=O)C=CC(=O)[C@@H]2CC=C[C@@H]3O[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C20H24O4SSi/c1-14-8-10-15(11-9-14)25(23)20-16(17(21)12-13-18(20)22)6-5-7-19(20)24-26(2,3)4/h5,7-13,16,19H,6H2,1-4H3/t16-,19-,20+,25-/m0/s1 |
| InChIKey | AUNLGLHKYDFNJD-BEWIQRDWSA-N |
| XLogP | 3.35 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|