C22H28O5SSi — CID 134980828
(4aS,8aS)-2-methoxy-4a-methyl-8a-[(S)-(4-methylphenyl)sulfinyl]-8-trimethylsilyloxy-5,8-dihydronaphthalene-1,4-dione (PubChem CID 134980828) has the molecular formula C22H28O5SSi and a molecular weight of 432.61 g/mol. Its IUPAC name is (4aS,8aS)-2-methoxy-4a-methyl-8a-[(S)-(4-methylphenyl)sulfinyl]-8-trimethylsilyloxy-5,8-dihydronaphthalene-1,4-dione.
| Compound Name | (4aS,8aS)-2-methoxy-4a-methyl-8a-[(S)-(4-methylphenyl)sulfinyl]-8-trimethylsilyloxy-5,8-dihydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 134980828 |
| Molecular Formula | C22H28O5SSi |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | (4aS,8aS)-2-methoxy-4a-methyl-8a-[(S)-(4-methylphenyl)sulfinyl]-8-trimethylsilyloxy-5,8-dihydronaphthalene-1,4-dione |
| SMILES | COC1=CC(=O)[C@]2(C)CC=CC(O[Si](C)(C)C)[C@]2([S@@](=O)c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C22H28O5SSi/c1-15-9-11-16(12-10-15)28(25)22-19(27-29(4,5)6)8-7-13-21(22,2)18(23)14-17(26-3)20(22)24/h7-12,14,19H,13H2,1-6H3/t19?,21-,22-,28-/m0/s1 |
| InChIKey | SQJFLFXVASTFPL-QPOJTJIOSA-N |
| XLogP | 3.71 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|