C23H30O5SSi — CID 134979552
(4aS,8S,8aR)-2-methoxy-4a,8-dimethyl-8a-[(S)-(4-methylphenyl)sulfinyl]-7-trimethylsilyloxy-5,8-dihydronaphthalene-1,4-dione (PubChem CID 134979552) has the molecular formula C23H30O5SSi and a molecular weight of 446.64 g/mol. Its IUPAC name is (4aS,8S,8aR)-2-methoxy-4a,8-dimethyl-8a-[(S)-(4-methylphenyl)sulfinyl]-7-trimethylsilyloxy-5,8-dihydronaphthalene-1,4-dione.
| Compound Name | (4aS,8S,8aR)-2-methoxy-4a,8-dimethyl-8a-[(S)-(4-methylphenyl)sulfinyl]-7-trimethylsilyloxy-5,8-dihydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 134979552 |
| Molecular Formula | C23H30O5SSi |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | (4aS,8S,8aR)-2-methoxy-4a,8-dimethyl-8a-[(S)-(4-methylphenyl)sulfinyl]-7-trimethylsilyloxy-5,8-dihydronaphthalene-1,4-dione |
| SMILES | COC1=CC(=O)[C@]2(C)CC=C(O[Si](C)(C)C)[C@H](C)[C@]2([S@@](=O)c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C23H30O5SSi/c1-15-8-10-17(11-9-15)29(26)23-16(2)18(28-30(5,6)7)12-13-22(23,3)20(24)14-19(27-4)21(23)25/h8-12,14,16H,13H2,1-7H3/t16-,22-,23-,29-/m0/s1 |
| InChIKey | RLYJACVTZVIXDJ-LHTMQIOBSA-N |
| XLogP | 4.31 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|