C21H24O4S — CID 11552488
(4aS,8aR)-2-methoxy-4a,6,7-trimethyl-8a-[(S)-(4-methylphenyl)sulfinyl]-5,8-dihydronaphthalene-1,4-dione (PubChem CID 11552488) has the molecular formula C21H24O4S and a molecular weight of 372.49 g/mol. Its IUPAC name is (4aS,8aR)-2-methoxy-4a,6,7-trimethyl-8a-[(S)-(4-methylphenyl)sulfinyl]-5,8-dihydronaphthalene-1,4-dione.
| Compound Name | (4aS,8aR)-2-methoxy-4a,6,7-trimethyl-8a-[(S)-(4-methylphenyl)sulfinyl]-5,8-dihydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 11552488 |
| Molecular Formula | C21H24O4S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | (4aS,8aR)-2-methoxy-4a,6,7-trimethyl-8a-[(S)-(4-methylphenyl)sulfinyl]-5,8-dihydronaphthalene-1,4-dione |
| SMILES | COC1=CC(=O)[C@]2(C)CC(C)=C(C)C[C@]2([S@@](=O)c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C21H24O4S/c1-13-6-8-16(9-7-13)26(24)21-12-15(3)14(2)11-20(21,4)18(22)10-17(25-5)19(21)23/h6-10H,11-12H2,1-5H3/t20-,21-,26-/m0/s1 |
| InChIKey | ZBPAXEUDSXKRAV-WOVHNISZSA-N |
| XLogP | 3.66 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|