C18H26O2SSi — CID 56600213
(4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-phenylsulfanylcyclohex-2-en-1-one (PubChem CID 56600213) has the molecular formula C18H26O2SSi and a molecular weight of 334.56 g/mol. Its IUPAC name is (4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-phenylsulfanylcyclohex-2-en-1-one.
| Compound Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-phenylsulfanylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 56600213 |
| Molecular Formula | C18H26O2SSi |
| Molecular Weight | 334.56 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-phenylsulfanylcyclohex-2-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C=CC(=O)C(Sc2ccccc2)C1 |
| InChI | InChI=1S/C18H26O2SSi/c1-18(2,3)22(4,5)20-14-11-12-16(19)17(13-14)21-15-9-7-6-8-10-15/h6-12,14,17H,13H2,1-5H3/t14-,17?/m1/s1 |
| InChIKey | AXSOCJMCFYOSOU-XPCCGILXSA-N |
| XLogP | 5.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|