C23H32O2S2Si — CID 59850525
5-[tert-butyl(dimethyl)silyl]oxy-3,3-bis(phenylsulfanyl)pentan-2-one (PubChem CID 59850525) has the molecular formula C23H32O2S2Si and a molecular weight of 432.73 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxy-3,3-bis(phenylsulfanyl)pentan-2-one.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxy-3,3-bis(phenylsulfanyl)pentan-2-one |
|---|---|
| PubChem CID | 59850525 |
| Molecular Formula | C23H32O2S2Si |
| Molecular Weight | 432.73 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxy-3,3-bis(phenylsulfanyl)pentan-2-one |
| SMILES | CC(=O)C(CCO[Si](C)(C)C(C)(C)C)(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C23H32O2S2Si/c1-19(24)23(26-20-13-9-7-10-14-20,27-21-15-11-8-12-16-21)17-18-25-28(5,6)22(2,3)4/h7-16H,17-18H2,1-6H3 |
| InChIKey | GIYMNIGNOAYPMK-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.73 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|