C26H36O2S2Si — CID 10939654
trans-(3S,4S)-3-[bis(phenylsulfanyl)methyl]-4-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxycyclopentan-1-one (PubChem CID 10939654) has the molecular formula C26H36O2S2Si and a molecular weight of 472.79 g/mol. Its IUPAC name is trans-(3S,4S)-3-[bis(phenylsulfanyl)methyl]-4-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxycyclopentan-1-one.
| Compound Name | trans-(3S,4S)-3-[bis(phenylsulfanyl)methyl]-4-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxycyclopentan-1-one |
|---|---|
| PubChem CID | 10939654 |
| Molecular Formula | C26H36O2S2Si |
| Molecular Weight | 472.79 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | trans-(3S,4S)-3-[bis(phenylsulfanyl)methyl]-4-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxycyclopentan-1-one |
| SMILES | CC(C)C(C)(C)[Si](C)(C)O[C@H]1CC(=O)C[C@@H]1C(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C26H36O2S2Si/c1-19(2)26(3,4)31(5,6)28-24-18-20(27)17-23(24)25(29-21-13-9-7-10-14-21)30-22-15-11-8-12-16-22/h7-16,19,23-25H,17-18H2,1-6H3/t23-,24-/m0/s1 |
| InChIKey | IGFMTZBLMZUXRW-ZEQRLZLVSA-N |
| XLogP | 7.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.79 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|