C24H36O3SSi — CID 10365540
(2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E)-3-methoxy-1-phenylsulfanylprop-2-enyl]-2-prop-2-enylcyclopentan-1-one (PubChem CID 10365540) has the molecular formula C24H36O3SSi and a molecular weight of 432.70 g/mol. Its IUPAC name is (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E)-3-methoxy-1-phenylsulfanylprop-2-enyl]-2-prop-2-enylcyclopentan-1-one.
| Compound Name | (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E)-3-methoxy-1-phenylsulfanylprop-2-enyl]-2-prop-2-enylcyclopentan-1-one |
|---|---|
| PubChem CID | 10365540 |
| Molecular Formula | C24H36O3SSi |
| Molecular Weight | 432.70 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E)-3-methoxy-1-phenylsulfanylprop-2-enyl]-2-prop-2-enylcyclopentan-1-one |
| SMILES | C=CC[C@H]1C(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C(/C=C/OC)Sc1ccccc1 |
| InChI | InChI=1S/C24H36O3SSi/c1-8-12-19-20(25)17-21(27-29(6,7)24(2,3)4)23(19)22(15-16-26-5)28-18-13-10-9-11-14-18/h8-11,13-16,19,21-23H,1,12,17H2,2-7H3/b16-15+/t19-,21+,22?,23+/m0/s1 |
| InChIKey | KKPFOUKNUPXAIV-GJBOPPKBSA-N |
| XLogP | 6.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.70 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|