C19H32O2SSi — CID 162057759
methane;trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfanylcyclopentan-1-one (PubChem CID 162057759) has the molecular formula C19H32O2SSi and a molecular weight of 352.62 g/mol. Its IUPAC name is methane;trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfanylcyclopentan-1-one.
| Compound Name | methane;trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfanylcyclopentan-1-one |
|---|---|
| PubChem CID | 162057759 |
| Molecular Formula | C19H32O2SSi |
| Molecular Weight | 352.62 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | methane;trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfanylcyclopentan-1-one |
| SMILES | C.Cc1ccc(S[C@H]2CC(=O)C[C@@H]2O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H28O2SSi.CH4/c1-13-7-9-15(10-8-13)21-17-12-14(19)11-16(17)20-22(5,6)18(2,3)4;/h7-10,16-17H,11-12H2,1-6H3;1H4/t16-,17-;/m0./s1 |
| InChIKey | YZKJJUQARJAIGZ-QJHJCNPRSA-N |
| XLogP | 5.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.62 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|