C24H36O2S2Si — CID 135006205
5-[bis(phenylsulfanyl)methoxy]pentoxy-tert-butyl-dimethylsilane (PubChem CID 135006205) has the molecular formula C24H36O2S2Si and a molecular weight of 448.77 g/mol. Its IUPAC name is 5-[bis(phenylsulfanyl)methoxy]pentoxy-tert-butyl-dimethylsilane.
| Compound Name | 5-[bis(phenylsulfanyl)methoxy]pentoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 135006205 |
| Molecular Formula | C24H36O2S2Si |
| Molecular Weight | 448.77 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 5-[bis(phenylsulfanyl)methoxy]pentoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCOC(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C24H36O2S2Si/c1-24(2,3)29(4,5)26-20-14-8-13-19-25-23(27-21-15-9-6-10-16-21)28-22-17-11-7-12-18-22/h6-7,9-12,15-18,23H,8,13-14,19-20H2,1-5H3 |
| InChIKey | HBVUTHCELQWRBL-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.77 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|