C26H38O3S2Si — CID 140532047
tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2,2-bis(phenylsulfanyl)butanoate (PubChem CID 140532047) has the molecular formula C26H38O3S2Si and a molecular weight of 490.81 g/mol. Its IUPAC name is tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2,2-bis(phenylsulfanyl)butanoate.
| Compound Name | tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2,2-bis(phenylsulfanyl)butanoate |
|---|---|
| PubChem CID | 140532047 |
| Molecular Formula | C26H38O3S2Si |
| Molecular Weight | 490.81 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2,2-bis(phenylsulfanyl)butanoate |
| SMILES | CC(C)(C)OC(=O)C(CCO[Si](C)(C)C(C)(C)C)(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C26H38O3S2Si/c1-24(2,3)29-23(27)26(30-21-15-11-9-12-16-21,31-22-17-13-10-14-18-22)19-20-28-32(7,8)25(4,5)6/h9-18H,19-20H2,1-8H3 |
| InChIKey | CCTCKRQYJGHEOZ-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.81 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|