C20H26O2SSi — CID 10247851
methyl (2R,3S)-3-[dimethyl(phenyl)silyl]-2-(phenylsulfanylmethyl)butanoate (PubChem CID 10247851) has the molecular formula C20H26O2SSi and a molecular weight of 358.58 g/mol. Its IUPAC name is methyl (2R,3S)-3-[dimethyl(phenyl)silyl]-2-(phenylsulfanylmethyl)butanoate.
| Compound Name | methyl (2R,3S)-3-[dimethyl(phenyl)silyl]-2-(phenylsulfanylmethyl)butanoate |
|---|---|
| PubChem CID | 10247851 |
| Molecular Formula | C20H26O2SSi |
| Molecular Weight | 358.58 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | methyl (2R,3S)-3-[dimethyl(phenyl)silyl]-2-(phenylsulfanylmethyl)butanoate |
| SMILES | COC(=O)[C@@H](CSc1ccccc1)[C@H](C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C20H26O2SSi/c1-16(24(3,4)18-13-9-6-10-14-18)19(20(21)22-2)15-23-17-11-7-5-8-12-17/h5-14,16,19H,15H2,1-4H3/t16-,19-/m0/s1 |
| InChIKey | OXLVLBJPKMKAAC-LPHOPBHVSA-N |
| XLogP | 4.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.58 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|