C17H29NO3SSi — CID 134918602
methyl 2-[N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]-S-phenylsulfonimidoyl]acetate (PubChem CID 134918602) has the molecular formula C17H29NO3SSi and a molecular weight of 355.58 g/mol. Its IUPAC name is methyl 2-[N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]-S-phenylsulfonimidoyl]acetate.
| Compound Name | methyl 2-[N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]-S-phenylsulfonimidoyl]acetate |
|---|---|
| PubChem CID | 134918602 |
| Molecular Formula | C17H29NO3SSi |
| Molecular Weight | 355.58 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | methyl 2-[N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]-S-phenylsulfonimidoyl]acetate |
| SMILES | COC(=O)CS(=O)(=N[Si](C)(C)C(C)(C)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H29NO3SSi/c1-14(2)17(3,4)23(6,7)18-22(20,13-16(19)21-5)15-11-9-8-10-12-15/h8-12,14H,13H2,1-7H3 |
| InChIKey | CYOCYMFBBYQKAL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.58 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|