C26H32O3SSi — CID 10950475
(7Z,12Z)-11-[tert-butyl(dimethyl)silyl]oxy-11-methyl-12-phenylsulfanyl-1-oxacyclotetradeca-7,12-dien-5,9-diyn-2-one (PubChem CID 10950475) has the molecular formula C26H32O3SSi and a molecular weight of 452.69 g/mol. Its IUPAC name is (7Z,12Z)-11-[tert-butyl(dimethyl)silyl]oxy-11-methyl-12-phenylsulfanyl-1-oxacyclotetradeca-7,12-dien-5,9-diyn-2-one.
| Compound Name | (7Z,12Z)-11-[tert-butyl(dimethyl)silyl]oxy-11-methyl-12-phenylsulfanyl-1-oxacyclotetradeca-7,12-dien-5,9-diyn-2-one |
|---|---|
| PubChem CID | 10950475 |
| Molecular Formula | C26H32O3SSi |
| Molecular Weight | 452.69 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | (7Z,12Z)-11-[tert-butyl(dimethyl)silyl]oxy-11-methyl-12-phenylsulfanyl-1-oxacyclotetradeca-7,12-dien-5,9-diyn-2-one |
| SMILES | CC1(O[Si](C)(C)C(C)(C)C)C#C/C=C\C#CCCC(=O)OC/C=C/1Sc1ccccc1 |
| InChI | InChI=1S/C26H32O3SSi/c1-25(2,3)31(5,6)29-26(4)20-15-10-8-7-9-14-18-24(27)28-21-19-23(26)30-22-16-12-11-13-17-22/h8,10-13,16-17,19H,14,18,21H2,1-6H3/b10-8-,23-19- |
| InChIKey | GBVXGQHVBGUDPT-VFUMFWQXSA-N |
| XLogP | 6.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.69 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|