C36H54O3SSi2 — CID 134976311
tri(propan-2-yl)silyl (3Z,8Z)-5-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-phenylsulfanylcyclotrideca-3,8-dien-6,10-diyne-1-carboxylate (PubChem CID 134976311) has the molecular formula C36H54O3SSi2 and a molecular weight of 623.06 g/mol. Its IUPAC name is tri(propan-2-yl)silyl (3Z,8Z)-5-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-phenylsulfanylcyclotrideca-3,8-dien-6,10-diyne-1-carboxylate.
| Compound Name | tri(propan-2-yl)silyl (3Z,8Z)-5-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-phenylsulfanylcyclotrideca-3,8-dien-6,10-diyne-1-carboxylate |
|---|---|
| PubChem CID | 134976311 |
| Molecular Formula | C36H54O3SSi2 |
| Molecular Weight | 623.06 g/mol |
| Exact Mass | 622.33 |
| IUPAC Name | tri(propan-2-yl)silyl (3Z,8Z)-5-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-phenylsulfanylcyclotrideca-3,8-dien-6,10-diyne-1-carboxylate |
| SMILES | CC(C)[Si](OC(=O)C1C/C=C(\Sc2ccccc2)C(C)(O[Si](C)(C)C(C)(C)C)C#C/C=C\C#CCC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C36H54O3SSi2/c1-28(2)42(29(3)4,30(5)6)38-34(37)31-22-18-15-13-14-16-21-27-36(10,39-41(11,12)35(7,8)9)33(26-25-31)40-32-23-19-17-20-24-32/h14,16-17,19-20,23-24,26,28-31H,18,22,25H2,1-12H3/b16-14-,33-26- |
| InChIKey | RBWHMEXFHXHADE-MWRDLBONSA-N |
| XLogP | 10.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.06 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|