C20H32O3SSi — CID 10199812
methyl (E)-7-[tert-butyl(dimethyl)silyl]oxy-3-phenylsulfanylhept-2-enoate (PubChem CID 10199812) has the molecular formula C20H32O3SSi and a molecular weight of 380.63 g/mol. Its IUPAC name is methyl (E)-7-[tert-butyl(dimethyl)silyl]oxy-3-phenylsulfanylhept-2-enoate.
| Compound Name | methyl (E)-7-[tert-butyl(dimethyl)silyl]oxy-3-phenylsulfanylhept-2-enoate |
|---|---|
| PubChem CID | 10199812 |
| Molecular Formula | C20H32O3SSi |
| Molecular Weight | 380.63 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | methyl (E)-7-[tert-butyl(dimethyl)silyl]oxy-3-phenylsulfanylhept-2-enoate |
| SMILES | COC(=O)/C=C(\CCCCO[Si](C)(C)C(C)(C)C)Sc1ccccc1 |
| InChI | InChI=1S/C20H32O3SSi/c1-20(2,3)25(5,6)23-15-11-10-14-18(16-19(21)22-4)24-17-12-8-7-9-13-17/h7-9,12-13,16H,10-11,14-15H2,1-6H3/b18-16+ |
| InChIKey | RZCNMZUJODAZNX-FBMGVBCBSA-N |
| XLogP | 6.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.63 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|