C29H38O5SSi — CID 10815969
(5R,8Z,12R,13Z)-12-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-12-methyl-13-phenylsulfanyl-1-oxacyclopentadeca-8,13-dien-6,10-diyn-2-one (PubChem CID 10815969) has the molecular formula C29H38O5SSi and a molecular weight of 526.77 g/mol. Its IUPAC name is (5R,8Z,12R,13Z)-12-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-12-methyl-13-phenylsulfanyl-1-oxacyclopentadeca-8,13-dien-6,10-diyn-2-one.
| Compound Name | (5R,8Z,12R,13Z)-12-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-12-methyl-13-phenylsulfanyl-1-oxacyclopentadeca-8,13-dien-6,10-diyn-2-one |
|---|---|
| PubChem CID | 10815969 |
| Molecular Formula | C29H38O5SSi |
| Molecular Weight | 526.77 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | (5R,8Z,12R,13Z)-12-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-12-methyl-13-phenylsulfanyl-1-oxacyclopentadeca-8,13-dien-6,10-diyn-2-one |
| SMILES | COCO[C@H]1C#C/C=C\C#C[C@@](C)(O[Si](C)(C)C(C)(C)C)/C(Sc2ccccc2)=C/COC(=O)CC1 |
| InChI | InChI=1S/C29H38O5SSi/c1-28(2,3)36(6,7)34-29(4)21-14-9-8-11-15-24(33-23-31-5)18-19-27(30)32-22-20-26(29)35-25-16-12-10-13-17-25/h8-10,12-13,16-17,20,24H,18-19,22-23H2,1-7H3/b9-8-,26-20-/t24-,29+/m0/s1 |
| InChIKey | OFZUNOHLLKMHGV-FZRXDQGTSA-N |
| XLogP | 6.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.77 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|